Chemistry · Haloalkanes And Haloarenes · NEET
Look at the carbon holding the halogen. In a haloalkane the halogen (X) is bonded to an sp3 carbon of an alkyl group, so the general formula is R-X (example: CH3-Cl, chloromethane). In a haloarene the halogen is bonded directly to an sp2 carbon of a benzene (aromatic) ring, general formula Ar-X (example: C6H5-Cl, chlorobenzene). Same halogen, but the type of carbon it sits on is what changes the name and the whole chemistry. NEET loves this because C-X bond strength and reactivity depend on that sp3-versus-sp2 carbon.
Chlorobenzene (C6H5Cl) is a haloarene. The Cl is joined straight to a carbon of the benzene ring, and that ring carbon is sp2 hybridised. If instead the Cl were on a -CH2- attached to the ring (like C6H5-CH2Cl, benzyl chloride), the carbon holding Cl would be sp3, so that would be a haloalkane, not a haloarene. Always trace which carbon actually carries the halogen.
R-X is the short general formula for a haloalkane. R means any alkyl group (like CH3-, C2H5-) and X means any halogen (F, Cl, Br, I). So R-X just says 'alkyl group with a halogen on it.' Ar-X is the general formula for a haloarene, where Ar means an aryl group (an aromatic ring like phenyl, C6H5-). Writing R-X or Ar-X lets you talk about the whole family in one symbol.
You must name it by the carbon holding the halogen, not the neighbour. If X is on an sp3 carbon that is next to a C=C double bond, it is an allylic halide (still a type of haloalkane). If X is directly on the sp2 carbon of the C=C double bond, it is a vinylic halide. If X is on the sp3 carbon next to a benzene ring, it is a benzylic halide (a haloalkane). If X is directly on the aromatic ring carbon, it is an aryl halide (a haloarene). NEET 2023 asked exactly this.
Because it decides reactivity. In haloalkanes the sp3 C-X bond is longer and weaker, and these compounds easily do substitution and elimination reactions. In haloarenes and vinylic halides the C-X bond has partial double-bond character (due to resonance with the ring or double bond), so it is shorter and stronger and much harder to break. That is why chlorobenzene does NOT react like an alkyl chloride. Knowing the class instantly tells you what reactions to expect.
Yes. The number of halogens only changes whether we call it mono-, di- or poly-halogen (for example CH2Cl2 is dichloromethane, CHCl3 is chloroform). It is still a haloalkane as long as each halogen sits on an sp3 alkyl carbon. The haloalkane-versus-haloarene split is only about which type of carbon the halogen is on, not how many halogens there are.
The compound C6H5-CH=CH-CH(Br)-CH2-CH3 (a benzene ring with a -CH=CH- unit, then an sp3 carbon bearing Br adjacent to the C=C) is an example of a:
Try the real previous-year questions from this chapter — each with the answer and a full solution.
A haloalkane is R-X, where R is an alkyl group and X is a halogen (F, Cl, Br, I), for example CH3Cl. A haloarene is Ar-X, where Ar is an aromatic (aryl) group, for example C6H5Cl (chlorobenzene).
Yes. 'Alkyl halide' is just the common older name and 'haloalkane' is the IUPAC-style name. Both mean a halogen atom bonded to an sp3 carbon of an alkyl group, formula R-X.
In a haloalkane the C-X carbon is sp3. In a haloarene the C-X carbon is sp2 (a benzene ring carbon). This single difference controls bond length, bond strength and how reactive the compound is.
They appear in many reaction questions (substitution, elimination, Grignard, Sandmeyer). Getting the class right first tells you which reactions are possible, so nearly every problem starts with correctly reading whether the halogen is on an sp3 or sp2 carbon.
Neither in the strict alkyl/aryl sense. A vinylic halide has X on an sp2 carbon of a C=C double bond (like CH2=CHCl). Its C-X bond behaves more like a haloarene: short, strong and unreactive to normal substitution, because of resonance with the double bond.
