Geometrical Isomerism (cis / trans, E / Z) — NEET Guide

Chemistry · General Principles Of Organic Chemistry · NEET

Geometrical isomerism is a type of stereoisomerism where two molecules have the same bonds but different fixed positions of groups around a C=C double bond (or a ring). It happens because the double bond cannot rotate freely. Memory hook: "Same side = cis, opposite side = trans." A molecule shows it only when each double-bond carbon carries two DIFFERENT groups.
Geometrical Isomers of But-2-ene (CH3-CH=CH-CH3)CH3CH3HHcis (same side)CH3CH3HHtrans (opposite sides)C=C cannot rotate -> positions are locked
But-2-ene has two geometrical isomers: cis (both CH3 on the same side of the locked C=C double bond) and trans (CH3 groups on opposite sides). Each double-bond carrying a CH3 and an H — two different groups — is why isomerism appears.

Your doubts, answered

What is geometrical isomerism in simple words?

It is when two molecules have exactly the same atoms and bonds, but the groups sit in different fixed places around a C=C double bond. Because a double bond cannot spin, the two arrangements cannot turn into each other. Example: but-2-ene has a cis form (two methyls on the same side) and a trans form (two methyls on opposite sides).

What is the difference between cis and trans isomers?

In the cis isomer, the two similar (or reference) groups are on the SAME side of the double bond. In the trans isomer, they are on OPPOSITE sides. Trans isomers are usually more stable because the bulky groups are farther apart and repel less.

Why does a C=C double bond not rotate?

A double bond is made of one sigma bond and one pi bond. The pi bond is formed by sideways overlap of p-orbitals. To rotate, you would have to break this pi bond, which needs a lot of energy. So the groups stay locked in place, and that locking is what creates geometrical isomers. Single bonds have no pi bond, so they rotate freely and show no geometrical isomerism.

When does a compound show geometrical isomerism?

Only when EACH carbon of the C=C double bond carries two DIFFERENT groups. If any one double-bond carbon has two identical groups (like two H or two CH3), there is no geometrical isomerism. Rings can also show cis/trans if two ring carbons each carry two different groups.

What is E and Z, and how is it different from cis/trans?

E/Z is a more exact system used when cis/trans is unclear. On each double-bond carbon, you rank the two groups by atomic number (CIP priority). If the two higher-priority groups are on the same side, it is Z (from German 'zusammen', together). If they are on opposite sides, it is E ('entgegen', opposite). Cis/trans compares 'like' groups; E/Z compares 'priority' groups, so they do not always match.

Why doesn't 2-methylprop-1-ene show geometrical isomerism?

2-Methylprop-1-ene is (CH3)2C=CH2. One double-bond carbon carries two identical methyl groups and the other carries two H atoms. Since a carbon has two identical groups, swapping sides gives the same molecule, so no cis/trans forms exist.

⚠️ The NEET trap
Assuming every alkene with a C=C double bond shows geometrical isomerism.
A compound shows geometrical isomerism ONLY if each double-bond carbon has two different groups. Terminal alkenes (=CH2) and carbons bearing two identical groups (like in 2,3-dimethylbut-2-ene) do NOT show it.
🧠 Check both carbons first: if either carbon has a matching pair, cross it out.

Real NEET questions

2023

Which amongst the following compounds will show geometrical isomerism?

A · 2-Methylprop-1-ene
B · 3,4-Dimethylhex-3-ene
C · Pent-1-ene
D · 2,3-Dimethylbut-2-ene
Solution: Geometrical isomerism needs each C=C carbon to carry two different groups. In 3,4-dimethylhex-3-ene, CH3CH2(CH3)C=C(CH3)CH2CH3, each doubly bonded carbon has an ethyl and a methyl (different), so cis and trans forms exist. The others each have a double-bond carbon with two identical groups or a terminal =CH2, so they cannot show it.
2025

Which one of the following compounds can exist as cis-trans isomers?

A · 1,1-Dimethylcyclopropane
B · 1,2-Dimethylcyclohexane
C · Pent-1-ene
D · 2-Methylhex-2-ene
Solution: Cis-trans isomerism needs two different groups on two carbons whose positions are fixed by a ring or a C=C bond. In 1,2-dimethylcyclohexane the two methyls are on adjacent ring carbons and can lie on the same face (cis) or opposite faces (trans). 1,1-dimethylcyclopropane has both methyls on one carbon; pent-1-ene is terminal (=CH2); and in 2-methylhex-2-ene one double-bond carbon bears two identical methyls, so those three cannot.

Solved General Principles Of Organic Chemistry NEET PYQs

Try the real previous-year questions from this chapter — each with the answer and a full solution.

See all 59 General Principles Of Organic Chemistry NEET PYQs ›
Next concept: Optical Isomerism & Chirality (NEET Organic Chemistry)Keep learning — 2 minFeeling ready? Solve the General Principles Of Organic Chemistry NEET PYQs ›Or practice on your phone — get the free MedicNEET app ›

Frequently asked

Do single bonds show geometrical isomerism?

No. Single bonds rotate freely, so groups are not locked in place. Geometrical isomerism needs a restriction to rotation, which comes from a C=C double bond or a ring.

Is maleic acid cis or trans?

Maleic acid is the cis isomer (both COOH groups on the same side) and fumaric acid is the trans isomer (COOH groups on opposite sides). Fumaric acid is more stable and has a higher melting point.

Which is more stable, cis or trans?

Usually trans is more stable, because the bulky groups are on opposite sides and repel each other less. Cis isomers have groups crowded on the same side, giving more steric strain.

Can rings show geometrical isomerism?

Yes. In a ring, rotation is also restricted. If two ring carbons each carry a different group, the groups can be on the same face (cis) or opposite faces (trans), like in 1,2-dimethylcyclohexane.