General Principles Of Organic Chemistry

The correct statement regarding a carbonyl compound having a hydrogen atom on its alpha-carbon is:

The correct statement regarding the comparison of staggered and eclipsed conformations of ethane is:

The reaction shown in the scheme can be classified as:

Which of the following biphenyls is optically active?

For the following reactions: (a) \ce{CH3CH2CH2Br + KOH -> CH3CH=CH2 + KBr + H2O} (b) a bromo-dimethylcyclohexane + \ce{KOH} gives the corresponding hydroxy-dimethylcyclohexane (\ce{Br} replaced by \ce{OH}) (c) \ce{cyclohexene + Br2 ->} 1,2-dibromocyclohexane Which of the following statements is correct?

The correct statement regarding the basicity of aryl amines is:

The pair of electrons in the given carbanion, \ce{CH3-C#C^-}, is present in which of the following orbitals?

Which of the following can be used as the halide component for a Friedel-Crafts reaction?

In which of the following molecules are all atoms coplanar?

Which among the given bicyclic ketone molecules (I), (II) and (III) can exhibit tautomerism?

The correct order of strengths of the carboxylic acids (I), (II) and (III) is:

Which one is the most acidic compound?

Which one is the correct order of acidity?

The correct increasing order of basic strength for the following compounds is: (I) aniline, (II) p-nitroaniline, (III) p-toluidine (4-methylaniline).

The correct statement regarding an electrophile is:

The most suitable method of separation of a 1:1 mixture of ortho- and para-nitrophenols is:

The IUPAC name of the compound shown (a six-carbon chain bearing a terminal \ce{-CHO}, an adjacent \ce{CH3} branch, a ketone \ce{C=O}, and a \ce{C=C} double bond) is:

In which of the following molecules is the order of hybridisation $sp^2$, $sp^2$, $sp$, $sp$ for the carbon atoms from left to right?

Which of the following carbocations is expected to be the most stable? (Each is a cyclohexadienyl-type cation bearing an \ce{-NO2} substituent on the ring, with the positive charge located at varying ring positions relative to the \ce{-NO2} group.)

Which of the following is correct with respect to the $-I$ effect of the substituents? (R = alkyl)

In the Reimer-Tiemann reaction, \ce{C6H5-O^- Na^+ + CHCl3 + NaOH -> } salicylaldehyde (o-hydroxybenzaldehyde), the electrophile involved is:

The number of sigma ($\sigma$) and pi ($\pi$) bonds in pent-2-en-4-yne is

Among the following, the reaction that proceeds through an electrophilic substitution is:

The compound that is most difficult to protonate is:

The correct order of the basic strength of methyl-substituted amines in aqueous solution is:

The most stable carbocation among the following is:

The most stable carbocation among the following is:

A tertiary butyl carbocation is more stable than the secondary butyl carbocation because of which one of the following?

Paper chromatography is an example of

For the elimination reaction of 2-bromopentane to form pent-2-ene, consider the following statements: (a) It is a $\beta$-elimination reaction. (b) It follows Zaitsev's rule. (c) It is a dehydrohalogenation reaction. Which of the statements are correct?

The compound which shows metamerism is:

An organic compound contains 78% (by wt.) carbon and the remaining percentage of hydrogen. The empirical formula of this compound is: [Atomic wt. of C = 12, H = 1]

Choose the correct skeletal structure for 2,6-dimethyldec-4-ene.

What is the IUPAC name of the organic compound formed in the following reaction? \ce{CH3-CO-CH3 ->[(i) C2H5MgBr, dry ether][(ii) H2O/H+] Product}

The dihedral angle of the least stable conformer of ethane is:

Statement I: The acidic strength of monosubstituted nitrophenol is higher than phenol because of the electron-withdrawing nitro group. Statement II: o-nitrophenol, m-nitrophenol and p-nitrophenol will have the same acidic strength as they have one nitro group attached to the phenolic ring. Choose the most appropriate answer.

The Kjeldahl's method for the estimation of nitrogen can be used to estimate the amount of nitrogen in which one of the following compounds?

The incorrect statement regarding chirality is:

The correct IUPAC name of the following compound is: \ce{CH3-CH(Cl)-CH(CH3)-CH(OH)-CH2-CH2-Br}

The correct IUPAC name of the following compound is:

Which amongst the following compounds will show geometrical isomerism?

Which amongst the following compounds/species is least basic?

Given below are two statements: Statement I: In an organic compound, when inductive and electromeric effects operate in opposite directions, the inductive effect predominates. Statement II: Hyperconjugation is observed in o-xylene. In the light of the above statements, choose the correct answer from the options given below.

In Lassaigne's extract of an organic compound, both nitrogen and sulphur are present, which gives a blood-red colour with \ce{Fe^3+} due to the formation of:

Which amongst the following compounds would be most readily dehydrated under acidic conditions?

The compound that will undergo SN1 reaction with the fastest rate is:

A compound with a molecular formula $\ce{C6H14}$ has two tertiary carbons. Its IUPAC name is:

On heating, some solid substances change from the solid to the vapour state without passing through the liquid state. The technique used for the purification of such substances based on the above principle is known as:

A compound X contains 32% of A, 20% of B and the remaining percentage of C. The empirical formula of X is (given atomic masses A = 64, B = 40, C = 32 u):

The correct order of decreasing acidity of the following aliphatic acids is:

Which one of the following reactions does NOT belong to Lassaigne's test?

How many products (including stereoisomers) are expected from the monochlorination of 2-methylbutane, $\ce{(CH3)2CH-CH2-CH3}$?

The total number of possible isomers (both structural as well as stereoisomers) of cyclic ethers of molecular formula $\ce{C4H8O}$ is:

Among the given compounds I-III, the correct order of bond dissociation energy of the C-H bond marked with an asterisk (*) is:

The correct order of decreasing basic strength of the given amines is:

Match List I (Mixture) with List II (Method of Separation). List I A. $\ce{CHCl3}$ + $\ce{C6H5NH2}$ B. Crude oil in the petroleum industry C. Glycerol from spent-lye D. Aniline-water List II I. Distillation under reduced pressure II. Steam distillation III. Fractional distillation IV. Simple distillation

Which one of the following compounds can exist as cis-trans isomers?

The carbocation $\ce{C6H5-\overset{+}{C}H-CH3}$ (1-phenylethyl cation) is stabilized by the interaction of the empty $p$ orbital with:

The pair of molecules that are metamers among the following is:

During Lassaigne's test, the elements present in an organic compound are converted from: